C32H36ClN5O3 — CID 67521914
N-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-N-cyclopentyl-4-phenylmethoxybutanamide (PubChem CID 67521914) has the molecular formula C32H36ClN5O3 and a molecular weight of 574.13 g/mol. Its IUPAC name is N-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-N-cyclopentyl-4-phenylmethoxybutanamide.
| Compound Name | N-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-N-cyclopentyl-4-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 67521914 |
| Molecular Formula | C32H36ClN5O3 |
| Molecular Weight | 574.13 g/mol |
| Exact Mass | 573.25 |
| IUPAC Name | N-[2-[5-(3-chloro-4-methoxyphenyl)-3-pyridin-4-yl-1,2,4-triazol-1-yl]ethyl]-N-cyclopentyl-4-phenylmethoxybutanamide |
| SMILES | COc1ccc(-c2nc(-c3ccncc3)nn2CCN(C(=O)CCCOCc2ccccc2)C2CCCC2)cc1Cl |
| InChI | InChI=1S/C32H36ClN5O3/c1-40-29-14-13-26(22-28(29)33)32-35-31(25-15-17-34-18-16-25)36-38(32)20-19-37(27-10-5-6-11-27)30(39)12-7-21-41-23-24-8-3-2-4-9-24/h2-4,8-9,13-18,22,27H,5-7,10-12,19-21,23H2,1H3 |
| InChIKey | ORAVBRLJBKTTQD-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 82.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.13 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|