C23H25N — CID 67522478
12-tert-butyl-5-ethyl-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene (PubChem CID 67522478) has the molecular formula C23H25N and a molecular weight of 315.46 g/mol. Its IUPAC name is 12-tert-butyl-5-ethyl-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene.
| Compound Name | 12-tert-butyl-5-ethyl-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 67522478 |
| Molecular Formula | C23H25N |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | 12-tert-butyl-5-ethyl-8-methyl-8-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2(7),3,5,9(17),10,12,14-octaene |
| SMILES | CCc1ccc2c(c1)N(C)c1ccc(C(C)(C)C)c3cccc-2c13 |
| InChI | InChI=1S/C23H25N/c1-6-15-10-11-16-17-8-7-9-18-19(23(2,3)4)12-13-20(22(17)18)24(5)21(16)14-15/h7-14H,6H2,1-5H3 |
| InChIKey | NRMANCVDTWYCIA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |