About (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole
(2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole (PubChem CID 67522535) has the molecular formula C9H17N
and a molecular weight of 139.24 g/mol. Its IUPAC name is (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole.
Molecular Properties
| Compound Name | (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole |
| PubChem CID | 67522535 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole |
| SMILES | CCC(C)[C@@H]1CC=CN1C |
| InChI | InChI=1S/C9H17N/c1-4-8(2)9-6-5-7-10(9)3/h5,7-9H,4,6H2,1-3H3/t8?,9-/m0/s1 |
| InChIKey | MYBNIVFBABNXGP-GKAPJAKFSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole?
The IUPAC name of (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole (CID 67522535) is (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole.
What is the SMILES notation for (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole?
The canonical SMILES for (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole is CCC(C)[C@@H]1CC=CN1C.
What is the InChIKey of (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole?
The InChIKey is MYBNIVFBABNXGP-GKAPJAKFSA-N. The full InChI is InChI=1S/C9H17N/c1-4-8(2)9-6-5-7-10(9)3/h5,7-9H,4,6H2,1-3H3/t8?,9-/m0/s1.
What are the key properties of (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole?
(2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole has a molecular weight of 139.24 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-butan-2-yl-1-methyl-2,3-dihydropyrrole is sourced from PubChem (CID 67522535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).