About 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene
2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene (PubChem CID 67522625) has the molecular formula C23H22F2O
and a molecular weight of 352.42 g/mol. Its IUPAC name is 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene.
Molecular Properties
| Compound Name | 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene |
| PubChem CID | 67522625 |
| Molecular Formula | C23H22F2O |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene |
| SMILES | CCc1ccc2c(c1)OC(F)(F)c1c-2ccc2cc(C(C)(C)C)ccc12 |
| InChI | InChI=1S/C23H22F2O/c1-5-14-6-9-18-19-10-7-15-13-16(22(2,3)4)8-11-17(15)21(19)23(24,25)26-20(18)12-14/h6-13H,5H2,1-4H3 |
| InChIKey | VYVMKJXODGSIMK-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene?
The IUPAC name of 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene (CID 67522625) is 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene.
What is the SMILES notation for 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene?
The canonical SMILES for 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene is CCc1ccc2c(c1)OC(F)(F)c1c-2ccc2cc(C(C)(C)C)ccc12.
What is the InChIKey of 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene?
The InChIKey is VYVMKJXODGSIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22F2O/c1-5-14-6-9-18-19-10-7-15-13-16(22(2,3)4)8-11-17(15)21(19)23(24,25)26-20(18)12-14/h6-13H,5H2,1-4H3.
What are the key properties of 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene?
2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene has a molecular weight of 352.42 g/mol, XLogP of 6.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-8-ethyl-5,5-difluoronaphtho[1,2-c]chromene is sourced from PubChem (CID 67522625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).