C31H40BN5O5 — CID 67522747
methyl N-[(2S)-1-[(2S,4S)-4-cyano-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 67522747) has the molecular formula C31H40BN5O5 and a molecular weight of 573.50 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2S,4S)-4-cyano-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[(2S,4S)-4-cyano-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67522747 |
| Molecular Formula | C31H40BN5O5 |
| Molecular Weight | 573.50 g/mol |
| Exact Mass | 573.31 |
| IUPAC Name | methyl N-[(2S)-1-[(2S,4S)-4-cyano-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4,5-dihydro-1H-imidazol-2-yl]pyrrolidin-1-yl]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@H](C(=O)N1C[C@@H](C#N)C[C@H]1C1=NCC(c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)N1)C(C)C |
| InChI | InChI=1S/C31H40BN5O5/c1-18(2)26(36-29(39)40-7)28(38)37-17-19(15-33)12-25(37)27-34-16-24(35-27)22-9-8-21-14-23(11-10-20(21)13-22)32-41-30(3,4)31(5,6)42-32/h8-11,13-14,18-19,24-26H,12,16-17H2,1-7H3,(H,34,35)(H,36,39)/t19-,24?,25+,26+/m1/s1 |
| InChIKey | AWKRDWBNBFVJOI-DZGADHCOSA-N |
| XLogP | 3.30 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.50 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|