C16H28O4 — CID 67522809
[(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-pent-4-enoxyoxan-3-yl] acetate (PubChem CID 67522809) has the molecular formula C16H28O4 and a molecular weight of 284.40 g/mol. Its IUPAC name is [(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-pent-4-enoxyoxan-3-yl] acetate.
| Compound Name | [(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-pent-4-enoxyoxan-3-yl] acetate |
|---|---|
| PubChem CID | 67522809 |
| Molecular Formula | C16H28O4 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | [(2S,4S,5S)-6-ethyl-4,5-dimethyl-2-pent-4-enoxyoxan-3-yl] acetate |
| SMILES | C=CCCCO[C@H]1OC(CC)[C@@H](C)[C@H](C)C1OC(C)=O |
| InChI | InChI=1S/C16H28O4/c1-6-8-9-10-18-16-15(19-13(5)17)12(4)11(3)14(7-2)20-16/h6,11-12,14-16H,1,7-10H2,2-5H3/t11-,12-,14?,15?,16-/m0/s1 |
| InChIKey | LFTQVXDFYPFVJZ-KKTZYWSQSA-N |
| XLogP | 3.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|