C29H35N8O6P — CID 67522929
(2S)-2-[[2-[2-amino-6-(cyclopropylamino)purin-9-yl]ethoxymethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-3-phenylpropanoic acid (PubChem CID 67522929) has the molecular formula C29H35N8O6P and a molecular weight of 622.62 g/mol. Its IUPAC name is (2S)-2-[[2-[2-amino-6-(cyclopropylamino)purin-9-yl]ethoxymethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[2-[2-amino-6-(cyclopropylamino)purin-9-yl]ethoxymethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 67522929 |
| Molecular Formula | C29H35N8O6P |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | (2S)-2-[[2-[2-amino-6-(cyclopropylamino)purin-9-yl]ethoxymethyl-[[(1S)-1-carboxy-2-phenylethyl]amino]phosphoryl]amino]-3-phenylpropanoic acid |
| SMILES | Nc1nc(NC2CC2)c2ncn(CCOCP(=O)(N[C@@H](Cc3ccccc3)C(=O)O)N[C@@H](Cc3ccccc3)C(=O)O)c2n1 |
| InChI | InChI=1S/C29H35N8O6P/c30-29-33-25(32-21-11-12-21)24-26(34-29)37(17-31-24)13-14-43-18-44(42,35-22(27(38)39)15-19-7-3-1-4-8-19)36-23(28(40)41)16-20-9-5-2-6-10-20/h1-10,17,21-23H,11-16,18H2,(H,38,39)(H,40,41)(H2,35,36,42)(H3,30,32,33,34)/t22-,23-/m0/s1 |
| InChIKey | KLWYUJOUTXAMCL-GOTSBHOMSA-N |
| XLogP | 2.72 |
| TPSA | 206.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|