C16H28F3NO4 — CID 67523144
tert-butyl (4S)-4-(1-butoxy-2,2,2-trifluoroethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 67523144) has the molecular formula C16H28F3NO4 and a molecular weight of 355.40 g/mol. Its IUPAC name is tert-butyl (4S)-4-(1-butoxy-2,2,2-trifluoroethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-(1-butoxy-2,2,2-trifluoroethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 67523144 |
| Molecular Formula | C16H28F3NO4 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | tert-butyl (4S)-4-(1-butoxy-2,2,2-trifluoroethyl)-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCOC([C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H28F3NO4/c1-7-8-9-22-12(16(17,18)19)11-10-23-15(5,6)20(11)13(21)24-14(2,3)4/h11-12H,7-10H2,1-6H3/t11-,12?/m0/s1 |
| InChIKey | YQJQAHAVPBFWIQ-PXYINDEMSA-N |
| XLogP | 4.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|