About 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide (PubChem CID 67523569) has the molecular formula C6H13IN2O
and a molecular weight of 256.09 g/mol. Its IUPAC name is 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide.
Molecular Properties
| Compound Name | 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide |
| PubChem CID | 67523569 |
| Molecular Formula | C6H13IN2O |
| Molecular Weight | 256.09 g/mol |
| Exact Mass | 256.01 |
| IUPAC Name | 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide |
| SMILES | CN1C=C[NH+](CCO)C1.[I-] |
| InChI | InChI=1S/C6H12N2O.HI/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H |
| InChIKey | QYDRCERBFSGNRP-UHFFFAOYSA-N |
| XLogP | -4.76 |
| TPSA | 27.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.09 |
| LogP ≤ 5 | -4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide?
The IUPAC name of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide (CID 67523569) is 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide.
What is the SMILES notation for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide?
The canonical SMILES for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide is CN1C=C[NH+](CCO)C1.[I-].
What is the InChIKey of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide?
The InChIKey is QYDRCERBFSGNRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.HI/c1-7-2-3-8(6-7)4-5-9;/h2-3,9H,4-6H2,1H3;1H.
What are the key properties of 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide?
2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide has a molecular weight of 256.09 g/mol, XLogP of -4.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-1,2-dihydroimidazol-1-ium-1-yl)ethanol iodide is sourced from PubChem (CID 67523569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).