C13H25N3O — CID 67523868
1-[[(8S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-8-yl]methyl]piperidin-4-amine (PubChem CID 67523868) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-[[(8S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-8-yl]methyl]piperidin-4-amine.
| Compound Name | 1-[[(8S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-8-yl]methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 67523868 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 1-[[(8S,8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-8-yl]methyl]piperidin-4-amine |
| SMILES | NC1CCN(C[C@@H]2CCN3CCOC[C@H]23)CC1 |
| InChI | InChI=1S/C13H25N3O/c14-12-2-4-15(5-3-12)9-11-1-6-16-7-8-17-10-13(11)16/h11-13H,1-10,14H2/t11-,13+/m0/s1 |
| InChIKey | BCLNZIRFQMAYAA-WCQYABFASA-N |
| XLogP | 0.13 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |