C19H24O5 — CID 67524040
2-[6-[4-(cyclopropanecarbonyl)phenyl]hexyl]propanedioic acid (PubChem CID 67524040) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 2-[6-[4-(cyclopropanecarbonyl)phenyl]hexyl]propanedioic acid.
| Compound Name | 2-[6-[4-(cyclopropanecarbonyl)phenyl]hexyl]propanedioic acid |
|---|---|
| PubChem CID | 67524040 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[6-[4-(cyclopropanecarbonyl)phenyl]hexyl]propanedioic acid |
| SMILES | O=C(c1ccc(CCCCCCC(C(=O)O)C(=O)O)cc1)C1CC1 |
| InChI | InChI=1S/C19H24O5/c20-17(15-11-12-15)14-9-7-13(8-10-14)5-3-1-2-4-6-16(18(21)22)19(23)24/h7-10,15-16H,1-6,11-12H2,(H,21,22)(H,23,24) |
| InChIKey | BEFMRASJYQZRJA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|