C10H13ClO2 — CID 67524164
5-chloro-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione (PubChem CID 67524164) has the molecular formula C10H13ClO2 and a molecular weight of 200.66 g/mol. Its IUPAC name is 5-chloro-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione.
| Compound Name | 5-chloro-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 67524164 |
| Molecular Formula | C10H13ClO2 |
| Molecular Weight | 200.66 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 5-chloro-2,2,6,6-tetramethylcyclohex-4-ene-1,3-dione |
| SMILES | CC1(C)C(=O)C=C(Cl)C(C)(C)C1=O |
| InChI | InChI=1S/C10H13ClO2/c1-9(2)6(11)5-7(12)10(3,4)8(9)13/h5H,1-4H3 |
| InChIKey | XANCPBUMIZBIAH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.66 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|