C21H22FN7O3 — CID 67524489
N'-[[3-fluoro-5-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-N-(2-hydroxyethyl)oxamide (PubChem CID 67524489) has the molecular formula C21H22FN7O3 and a molecular weight of 439.45 g/mol. Its IUPAC name is N'-[[3-fluoro-5-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-N-(2-hydroxyethyl)oxamide.
| Compound Name | N'-[[3-fluoro-5-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-N-(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 67524489 |
| Molecular Formula | C21H22FN7O3 |
| Molecular Weight | 439.45 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | N'-[[3-fluoro-5-[3-methyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]phenyl]methyl]-N-(2-hydroxyethyl)oxamide |
| SMILES | CNc1nc2[nH]c(-c3cc(F)cc(CNC(=O)C(=O)NCCO)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C21H22FN7O3/c1-23-19-16-17(29(2)10-26-16)14-8-15(27-18(14)28-19)12-5-11(6-13(22)7-12)9-25-21(32)20(31)24-3-4-30/h5-8,10,30H,3-4,9H2,1-2H3,(H,24,31)(H,25,32)(H2,23,27,28) |
| InChIKey | WMCGJLLBCILCIK-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 136.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.45 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|