C24H29BO5S — CID 67524621
tert-butyl [1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-4-yl] carbonate (PubChem CID 67524621) has the molecular formula C24H29BO5S and a molecular weight of 440.37 g/mol. Its IUPAC name is tert-butyl [1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-4-yl] carbonate.
| Compound Name | tert-butyl [1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-4-yl] carbonate |
|---|---|
| PubChem CID | 67524621 |
| Molecular Formula | C24H29BO5S |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | tert-butyl [1-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-thioxanthen-4-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(B2OC(C)(C)C(C)(C)O2)c2c1Sc1ccccc1C2 |
| InChI | InChI=1S/C24H29BO5S/c1-22(2,3)28-21(26)27-18-13-12-17(25-29-23(4,5)24(6,7)30-25)16-14-15-10-8-9-11-19(15)31-20(16)18/h8-13H,14H2,1-7H3 |
| InChIKey | TYONVWUBVAVFDI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|