About 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese
1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese (PubChem CID 67524753) has the molecular formula C16H21Cl2MnN6-
and a molecular weight of 423.23 g/mol. Its IUPAC name is 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese.
Molecular Properties
| Compound Name | 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese |
| PubChem CID | 67524753 |
| Molecular Formula | C16H21Cl2MnN6- |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese |
| SMILES | Cc1cc(C)n([C-](n2nc(C)cc2C)n2nc(C)cc2C)n1.Cl[Mn]Cl |
| InChI | InChI=1S/C16H21N6.2ClH.Mn/c1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;;;/h7-9H,1-6H3;2*1H;/q-1;;;+2/p-2 |
| InChIKey | MKWADUOVGWFXDP-UHFFFAOYSA-L |
| XLogP | 3.89 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese?
The IUPAC name of 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese (CID 67524753) is 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese.
What is the SMILES notation for 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese?
The canonical SMILES for 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese is Cc1cc(C)n([C-](n2nc(C)cc2C)n2nc(C)cc2C)n1.Cl[Mn]Cl.
What is the InChIKey of 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese?
The InChIKey is MKWADUOVGWFXDP-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H21N6.2ClH.Mn/c1-10-7-13(4)20(17-10)16(21-14(5)8-11(2)18-21)22-15(6)9-12(3)19-22;;;/h7-9H,1-6H3;2*1H;/q-1;;;+2/p-2.
What are the key properties of 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese?
1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese has a molecular weight of 423.23 g/mol, XLogP of 3.89, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[bis(3,5-dimethylpyrazol-1-yl)methyl]-3,5-dimethylpyrazole;dichloromanganese is sourced from PubChem (CID 67524753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).