C18H15FN6 — CID 67526107
3-[3,10-dimethyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-5-fluorobenzonitrile (PubChem CID 67526107) has the molecular formula C18H15FN6 and a molecular weight of 334.36 g/mol. Its IUPAC name is 3-[3,10-dimethyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-5-fluorobenzonitrile.
| Compound Name | 3-[3,10-dimethyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 67526107 |
| Molecular Formula | C18H15FN6 |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 3-[3,10-dimethyl-7-(methylamino)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-11-yl]-5-fluorobenzonitrile |
| SMILES | CNc1nc2c(cc(-c3cc(F)cc(C#N)c3)n2C)c2c1ncn2C |
| InChI | InChI=1S/C18H15FN6/c1-21-17-15-16(24(2)9-22-15)13-7-14(25(3)18(13)23-17)11-4-10(8-20)5-12(19)6-11/h4-7,9H,1-3H3,(H,21,23) |
| InChIKey | KKCKTWUDDQUCGP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 71.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |