C19H21N7O — CID 67526109
N,3-dimethyl-11-(6-morpholin-4-yl-2-pyridinyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine (PubChem CID 67526109) has the molecular formula C19H21N7O and a molecular weight of 363.43 g/mol. Its IUPAC name is N,3-dimethyl-11-(6-morpholin-4-yl-2-pyridinyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine.
| Compound Name | N,3-dimethyl-11-(6-morpholin-4-yl-2-pyridinyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
|---|---|
| PubChem CID | 67526109 |
| Molecular Formula | C19H21N7O |
| Molecular Weight | 363.43 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N,3-dimethyl-11-(6-morpholin-4-yl-2-pyridinyl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
| SMILES | CNc1nc2[nH]c(-c3cccc(N4CCOCC4)n3)cc2c2c1ncn2C |
| InChI | InChI=1S/C19H21N7O/c1-20-19-16-17(25(2)11-21-16)12-10-14(23-18(12)24-19)13-4-3-5-15(22-13)26-6-8-27-9-7-26/h3-5,10-11H,6-9H2,1-2H3,(H2,20,23,24) |
| InChIKey | HLCSIFFBWXRIBH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.43 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |