C16H23N3O3 — CID 67526452
(2S)-4-[(4-acetamido-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylic acid (PubChem CID 67526452) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is (2S)-4-[(4-acetamido-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylic acid.
| Compound Name | (2S)-4-[(4-acetamido-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 67526452 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | (2S)-4-[(4-acetamido-2-methylphenyl)methyl]-2-methylpiperazine-1-carboxylic acid |
| SMILES | CC(=O)Nc1ccc(CN2CCN(C(=O)O)[C@@H](C)C2)c(C)c1 |
| InChI | InChI=1S/C16H23N3O3/c1-11-8-15(17-13(3)20)5-4-14(11)10-18-6-7-19(16(21)22)12(2)9-18/h4-5,8,12H,6-7,9-10H2,1-3H3,(H,17,20)(H,21,22)/t12-/m0/s1 |
| InChIKey | XLJKNXSSKQLVSD-LBPRGKRZSA-N |
| XLogP | 2.14 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |