C22H21FN6O2 — CID 67526908
tert-butyl N-[11-(3-cyano-4-fluorophenyl)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate (PubChem CID 67526908) has the molecular formula C22H21FN6O2 and a molecular weight of 420.45 g/mol. Its IUPAC name is tert-butyl N-[11-(3-cyano-4-fluorophenyl)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[11-(3-cyano-4-fluorophenyl)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 67526908 |
| Molecular Formula | C22H21FN6O2 |
| Molecular Weight | 420.45 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | tert-butyl N-[11-(3-cyano-4-fluorophenyl)-3-methyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)c1nc2[nH]c(-c3ccc(F)c(C#N)c3)cc2c2c1ncn2C |
| InChI | InChI=1S/C22H21FN6O2/c1-22(2,3)31-21(30)29(5)20-17-18(28(4)11-25-17)14-9-16(26-19(14)27-20)12-6-7-15(23)13(8-12)10-24/h6-9,11H,1-5H3,(H,26,27) |
| InChIKey | ORPHAWVZEKMXGR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |