C17H17N5O — CID 67526983
11-(4-methoxyphenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine (PubChem CID 67526983) has the molecular formula C17H17N5O and a molecular weight of 307.36 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine.
| Compound Name | 11-(4-methoxyphenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
|---|---|
| PubChem CID | 67526983 |
| Molecular Formula | C17H17N5O |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | 11-(4-methoxyphenyl)-N,3-dimethyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-7-amine |
| SMILES | CNc1nc2[nH]c(-c3ccc(OC)cc3)cc2c2c1ncn2C |
| InChI | InChI=1S/C17H17N5O/c1-18-17-14-15(22(2)9-19-14)12-8-13(20-16(12)21-17)10-4-6-11(23-3)7-5-10/h4-9H,1-3H3,(H2,18,20,21) |
| InChIKey | FRRCRDDILBCGRO-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |