C14H10FN3O3 — CID 67526985
6-fluoro-N-[(3-nitrophenyl)methyl]-1,2-benzoxazol-3-amine (PubChem CID 67526985) has the molecular formula C14H10FN3O3 and a molecular weight of 287.25 g/mol. Its IUPAC name is 6-fluoro-N-[(3-nitrophenyl)methyl]-1,2-benzoxazol-3-amine.
| Compound Name | 6-fluoro-N-[(3-nitrophenyl)methyl]-1,2-benzoxazol-3-amine |
|---|---|
| PubChem CID | 67526985 |
| Molecular Formula | C14H10FN3O3 |
| Molecular Weight | 287.25 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 6-fluoro-N-[(3-nitrophenyl)methyl]-1,2-benzoxazol-3-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2noc3cc(F)ccc23)c1 |
| InChI | InChI=1S/C14H10FN3O3/c15-10-4-5-12-13(7-10)21-17-14(12)16-8-9-2-1-3-11(6-9)18(19)20/h1-7H,8H2,(H,16,17) |
| InChIKey | OLWKZRHGWVHWMK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 81.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|