About 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene
4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene (PubChem CID 67527222) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene.
Molecular Properties
| Compound Name | 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene |
| PubChem CID | 67527222 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene |
| SMILES | C/C=C\O/C=C\C.CC1COC(=O)O1 |
| InChI | InChI=1S/C6H10O.C4H6O3/c1-3-5-7-6-4-2;1-3-2-6-4(5)7-3/h3-6H,1-2H3;3H,2H2,1H3/b5-3-,6-4-; |
| InChIKey | CFBIJCTVJKLRCH-VIOUERSGSA-N |
| XLogP | 2.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
The IUPAC name of 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene (CID 67527222) is 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene.
What is the SMILES notation for 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
The canonical SMILES for 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene is C/C=C\O/C=C\C.CC1COC(=O)O1.
What is the InChIKey of 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
The InChIKey is CFBIJCTVJKLRCH-VIOUERSGSA-N. The full InChI is InChI=1S/C6H10O.C4H6O3/c1-3-5-7-6-4-2;1-3-2-6-4(5)7-3/h3-6H,1-2H3;3H,2H2,1H3/b5-3-,6-4-;.
What are the key properties of 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene?
4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene has a molecular weight of 200.23 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,3-dioxolan-2-one;(Z)-1-[(Z)-prop-1-enoxy]prop-1-ene is sourced from PubChem (CID 67527222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).