C17H19FN4O4 — CID 67527269
[1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid (PubChem CID 67527269) has the molecular formula C17H19FN4O4 and a molecular weight of 362.36 g/mol. Its IUPAC name is [1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid.
| Compound Name | [1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 67527269 |
| Molecular Formula | C17H19FN4O4 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | [1-[(5-fluoro-3-hydroxy-11-oxo-1,7-diazatricyclo[6.3.1.04,12]dodeca-4(12),5,7,9-tetraen-3-yl)methyl]piperidin-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(CC2(O)Cn3c(=O)ccc4ncc(F)c2c43)CC1 |
| InChI | InChI=1S/C17H19FN4O4/c18-11-7-19-12-1-2-13(23)22-9-17(26,14(11)15(12)22)8-21-5-3-10(4-6-21)20-16(24)25/h1-2,7,10,20,26H,3-6,8-9H2,(H,24,25) |
| InChIKey | ALVZUUWFXSFHRV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |