About N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine
N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine (PubChem CID 67527305) has the molecular formula C23H21FN2O2
and a molecular weight of 376.43 g/mol. Its IUPAC name is N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine |
| PubChem CID | 67527305 |
| Molecular Formula | C23H21FN2O2 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine |
| SMILES | Cc1cc(CNc2noc3cc(F)ccc23)cc(C)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H21FN2O2/c1-15-10-18(11-16(2)22(15)27-14-17-6-4-3-5-7-17)13-25-23-20-9-8-19(24)12-21(20)28-26-23/h3-12H,13-14H2,1-2H3,(H,25,26) |
| InChIKey | MWEYLIZUDJXPPN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine?
The IUPAC name of N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine (CID 67527305) is N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine.
What is the SMILES notation for N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine?
The canonical SMILES for N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine is Cc1cc(CNc2noc3cc(F)ccc23)cc(C)c1OCc1ccccc1.
What is the InChIKey of N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine?
The InChIKey is MWEYLIZUDJXPPN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21FN2O2/c1-15-10-18(11-16(2)22(15)27-14-17-6-4-3-5-7-17)13-25-23-20-9-8-19(24)12-21(20)28-26-23/h3-12H,13-14H2,1-2H3,(H,25,26).
What are the key properties of N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine?
N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine has a molecular weight of 376.43 g/mol, XLogP of 5.77, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,5-dimethyl-4-phenylmethoxyphenyl)methyl]-6-fluoro-1,2-benzoxazol-3-amine is sourced from PubChem (CID 67527305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).