C32H32Cl2N4O3 — CID 67527813
1-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]indole-7-carboxylic acid (PubChem CID 67527813) has the molecular formula C32H32Cl2N4O3 and a molecular weight of 591.54 g/mol. Its IUPAC name is 1-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]indole-7-carboxylic acid.
| Compound Name | 1-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]indole-7-carboxylic acid |
|---|---|
| PubChem CID | 67527813 |
| Molecular Formula | C32H32Cl2N4O3 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 590.19 |
| IUPAC Name | 1-[2-[4-[[1-(2,6-dichlorophenyl)-4-propan-2-ylpyrazol-5-yl]methoxy]-N,2-dimethylanilino]ethyl]indole-7-carboxylic acid |
| SMILES | Cc1cc(OCc2c(C(C)C)cnn2-c2c(Cl)cccc2Cl)ccc1N(C)CCn1ccc2cccc(C(=O)O)c21 |
| InChI | InChI=1S/C32H32Cl2N4O3/c1-20(2)25-18-35-38(31-26(33)9-6-10-27(31)34)29(25)19-41-23-11-12-28(21(3)17-23)36(4)15-16-37-14-13-22-7-5-8-24(30(22)37)32(39)40/h5-14,17-18,20H,15-16,19H2,1-4H3,(H,39,40) |
| InChIKey | OKSCYRBBLSGVFI-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|