C24H22BrF3N2 — CID 67527909
2-[2-(4-bromo-1-bicyclo[2.2.2]octanyl)ethenyl]-6-[2-(trifluoromethyl)phenyl]-1H-benzimidazole (PubChem CID 67527909) has the molecular formula C24H22BrF3N2 and a molecular weight of 475.35 g/mol. Its IUPAC name is 2-[2-(4-bromo-1-bicyclo[2.2.2]octanyl)ethenyl]-6-[2-(trifluoromethyl)phenyl]-1H-benzimidazole.
| Compound Name | 2-[2-(4-bromo-1-bicyclo[2.2.2]octanyl)ethenyl]-6-[2-(trifluoromethyl)phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 67527909 |
| Molecular Formula | C24H22BrF3N2 |
| Molecular Weight | 475.35 g/mol |
| Exact Mass | 474.09 |
| IUPAC Name | 2-[2-(4-bromo-1-bicyclo[2.2.2]octanyl)ethenyl]-6-[2-(trifluoromethyl)phenyl]-1H-benzimidazole |
| SMILES | FC(F)(F)c1ccccc1-c1ccc2nc(C=CC34CCC(Br)(CC3)CC4)[nH]c2c1 |
| InChI | InChI=1S/C24H22BrF3N2/c25-23-12-9-22(10-13-23,11-14-23)8-7-21-29-19-6-5-16(15-20(19)30-21)17-3-1-2-4-18(17)24(26,27)28/h1-8,15H,9-14H2,(H,29,30) |
| InChIKey | ZYYMBFBSMMYHJW-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.35 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|