C12H20N2O — CID 67528464
2,6-dimethyl-1-morpholin-4-ylcyclohexa-2,4-dien-1-amine (PubChem CID 67528464) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 2,6-dimethyl-1-morpholin-4-ylcyclohexa-2,4-dien-1-amine.
| Compound Name | 2,6-dimethyl-1-morpholin-4-ylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67528464 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2,6-dimethyl-1-morpholin-4-ylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1=CC=CC(C)C1(N)N1CCOCC1 |
| InChI | InChI=1S/C12H20N2O/c1-10-4-3-5-11(2)12(10,13)14-6-8-15-9-7-14/h3-5,10H,6-9,13H2,1-2H3 |
| InChIKey | JYOFJRQPUAHDNV-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |