C30H38N4O6S — CID 67528539
2-[2-methoxyethyl(methyl)amino]-N-[2-(oxan-4-ylcarbamoyl)-4-(3-phenylmethoxypropoxy)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 67528539) has the molecular formula C30H38N4O6S and a molecular weight of 582.72 g/mol. Its IUPAC name is 2-[2-methoxyethyl(methyl)amino]-N-[2-(oxan-4-ylcarbamoyl)-4-(3-phenylmethoxypropoxy)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[2-methoxyethyl(methyl)amino]-N-[2-(oxan-4-ylcarbamoyl)-4-(3-phenylmethoxypropoxy)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 67528539 |
| Molecular Formula | C30H38N4O6S |
| Molecular Weight | 582.72 g/mol |
| Exact Mass | 582.25 |
| IUPAC Name | 2-[2-methoxyethyl(methyl)amino]-N-[2-(oxan-4-ylcarbamoyl)-4-(3-phenylmethoxypropoxy)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | COCCN(C)c1nc(C(=O)Nc2ccc(OCCCOCc3ccccc3)cc2C(=O)NC2CCOCC2)cs1 |
| InChI | InChI=1S/C30H38N4O6S/c1-34(13-18-37-2)30-33-27(21-41-30)29(36)32-26-10-9-24(19-25(26)28(35)31-23-11-16-38-17-12-23)40-15-6-14-39-20-22-7-4-3-5-8-22/h3-5,7-10,19,21,23H,6,11-18,20H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | CYVBZSGETVPEOH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.72 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|