C11H15N3O — CID 67528751
(1R,5S)-3-pyrimidin-2-yloxy-8-azabicyclo[3.2.1]octane (PubChem CID 67528751) has the molecular formula C11H15N3O and a molecular weight of 205.26 g/mol. Its IUPAC name is (1R,5S)-3-pyrimidin-2-yloxy-8-azabicyclo[3.2.1]octane.
| Compound Name | (1R,5S)-3-pyrimidin-2-yloxy-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 67528751 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | (1R,5S)-3-pyrimidin-2-yloxy-8-azabicyclo[3.2.1]octane |
| SMILES | c1cnc(OC2C[C@H]3CC[C@@H](C2)N3)nc1 |
| InChI | InChI=1S/C11H15N3O/c1-4-12-11(13-5-1)15-10-6-8-2-3-9(7-10)14-8/h1,4-5,8-10,14H,2-3,6-7H2/t8-,9+,10? |
| InChIKey | SOTJZYBCLAHUFS-ULKQDVFKSA-N |
| XLogP | 1.14 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |