C12H17N5 — CID 67528754
6-cyclohexyl-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine (PubChem CID 67528754) has the molecular formula C12H17N5 and a molecular weight of 231.30 g/mol. Its IUPAC name is 6-cyclohexyl-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine.
| Compound Name | 6-cyclohexyl-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine |
|---|---|
| PubChem CID | 67528754 |
| Molecular Formula | C12H17N5 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 6-cyclohexyl-[1,2,4]triazolo[1,5-a]pyridine-2,5-diamine |
| SMILES | Nc1nc2ccc(C3CCCCC3)c(N)n2n1 |
| InChI | InChI=1S/C12H17N5/c13-11-9(8-4-2-1-3-5-8)6-7-10-15-12(14)16-17(10)11/h6-8H,1-5,13H2,(H2,14,16) |
| InChIKey | RJSYJDZRWZWHAN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 82.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |