About [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol
[1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol (PubChem CID 67528798) has the molecular formula C14H13F5N2O
and a molecular weight of 320.26 g/mol. Its IUPAC name is [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol.
Molecular Properties
| Compound Name | [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol |
| PubChem CID | 67528798 |
| Molecular Formula | C14H13F5N2O |
| Molecular Weight | 320.26 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol |
| SMILES | CC(C)c1cnn(-c2cc(F)cc(F)c2C(F)(F)F)c1CO |
| InChI | InChI=1S/C14H13F5N2O/c1-7(2)9-5-20-21(12(9)6-22)11-4-8(15)3-10(16)13(11)14(17,18)19/h3-5,7,22H,6H2,1-2H3 |
| InChIKey | QMDCCDFUWHNAIK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol?
The IUPAC name of [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol (CID 67528798) is [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol.
What is the SMILES notation for [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol?
The canonical SMILES for [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol is CC(C)c1cnn(-c2cc(F)cc(F)c2C(F)(F)F)c1CO.
What is the InChIKey of [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol?
The InChIKey is QMDCCDFUWHNAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F5N2O/c1-7(2)9-5-20-21(12(9)6-22)11-4-8(15)3-10(16)13(11)14(17,18)19/h3-5,7,22H,6H2,1-2H3.
What are the key properties of [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol?
[1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol has a molecular weight of 320.26 g/mol, XLogP of 3.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[3,5-difluoro-2-(trifluoromethyl)phenyl]-4-propan-2-ylpyrazol-5-yl]methanol is sourced from PubChem (CID 67528798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).