About methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate
methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate (PubChem CID 67528802) has the molecular formula C25H22BrF3O4
and a molecular weight of 523.35 g/mol. Its IUPAC name is methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate |
| PubChem CID | 67528802 |
| Molecular Formula | C25H22BrF3O4 |
| Molecular Weight | 523.35 g/mol |
| Exact Mass | 522.07 |
| IUPAC Name | methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccccc2C(F)(F)F)c(C)c1.COC(=O)c1ccc(Br)c(C)c1 |
| InChI | InChI=1S/C16H13F3O2.C9H9BrO2/c1-10-9-11(15(20)21-2)7-8-12(10)13-5-3-4-6-14(13)16(17,18)19;1-6-5-7(9(11)12-2)3-4-8(6)10/h3-9H,1-2H3;3-5H,1-2H3 |
| InChIKey | DSKYDVLFUBCDGK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 523.35 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate?
The IUPAC name of methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate (CID 67528802) is methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate.
What is the SMILES notation for methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate?
The canonical SMILES for methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate is COC(=O)c1ccc(-c2ccccc2C(F)(F)F)c(C)c1.COC(=O)c1ccc(Br)c(C)c1.
What is the InChIKey of methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate?
The InChIKey is DSKYDVLFUBCDGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3O2.C9H9BrO2/c1-10-9-11(15(20)21-2)7-8-12(10)13-5-3-4-6-14(13)16(17,18)19;1-6-5-7(9(11)12-2)3-4-8(6)10/h3-9H,1-2H3;3-5H,1-2H3.
What are the key properties of methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate?
methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate has a molecular weight of 523.35 g/mol, XLogP of 7.01, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-bromo-3-methylbenzoate;methyl 3-methyl-4-[2-(trifluoromethyl)phenyl]benzoate is sourced from PubChem (CID 67528802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).