C20H25N7O4 — CID 67528939
1-ethyl-N'-[2-(5-methyl-1,2-oxazol-3-yl)acetyl]-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide (PubChem CID 67528939) has the molecular formula C20H25N7O4 and a molecular weight of 427.47 g/mol. Its IUPAC name is 1-ethyl-N'-[2-(5-methyl-1,2-oxazol-3-yl)acetyl]-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide.
| Compound Name | 1-ethyl-N'-[2-(5-methyl-1,2-oxazol-3-yl)acetyl]-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide |
|---|---|
| PubChem CID | 67528939 |
| Molecular Formula | C20H25N7O4 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 1-ethyl-N'-[2-(5-methyl-1,2-oxazol-3-yl)acetyl]-4-(oxan-4-ylamino)pyrazolo[3,4-b]pyridine-5-carbohydrazide |
| SMILES | CCn1ncc2c(NC3CCOCC3)c(C(=O)NNC(=O)Cc3cc(C)on3)cnc21 |
| InChI | InChI=1S/C20H25N7O4/c1-3-27-19-15(11-22-27)18(23-13-4-6-30-7-5-13)16(10-21-19)20(29)25-24-17(28)9-14-8-12(2)31-26-14/h8,10-11,13H,3-7,9H2,1-2H3,(H,21,23)(H,24,28)(H,25,29) |
| InChIKey | QBDKDLKJHUXCNA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 136.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|