About 2-(1,4-dimethylpyrazol-3-yl)acetic acid
2-(1,4-dimethylpyrazol-3-yl)acetic acid (PubChem CID 67528971) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 2-(1,4-dimethylpyrazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(1,4-dimethylpyrazol-3-yl)acetic acid |
| PubChem CID | 67528971 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2-(1,4-dimethylpyrazol-3-yl)acetic acid |
| SMILES | Cc1cn(C)nc1CC(=O)O |
| InChI | InChI=1S/C7H10N2O2/c1-5-4-9(2)8-6(5)3-7(10)11/h4H,3H2,1-2H3,(H,10,11) |
| InChIKey | HPQXWISVUONRON-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(1,4-dimethylpyrazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dimethylpyrazol-3-yl)acetic acid?
The IUPAC name of 2-(1,4-dimethylpyrazol-3-yl)acetic acid (CID 67528971) is 2-(1,4-dimethylpyrazol-3-yl)acetic acid.
What is the SMILES notation for 2-(1,4-dimethylpyrazol-3-yl)acetic acid?
The canonical SMILES for 2-(1,4-dimethylpyrazol-3-yl)acetic acid is Cc1cn(C)nc1CC(=O)O.
What is the InChIKey of 2-(1,4-dimethylpyrazol-3-yl)acetic acid?
The InChIKey is HPQXWISVUONRON-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-5-4-9(2)8-6(5)3-7(10)11/h4H,3H2,1-2H3,(H,10,11).
What are the key properties of 2-(1,4-dimethylpyrazol-3-yl)acetic acid?
2-(1,4-dimethylpyrazol-3-yl)acetic acid has a molecular weight of 154.17 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dimethylpyrazol-3-yl)acetic acid is sourced from PubChem (CID 67528971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).