C16H19IN6O2 — CID 67529190
1-(1-iodoethyl)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine (PubChem CID 67529190) has the molecular formula C16H19IN6O2 and a molecular weight of 454.27 g/mol. Its IUPAC name is 1-(1-iodoethyl)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine.
| Compound Name | 1-(1-iodoethyl)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
|---|---|
| PubChem CID | 67529190 |
| Molecular Formula | C16H19IN6O2 |
| Molecular Weight | 454.27 g/mol |
| Exact Mass | 454.06 |
| IUPAC Name | 1-(1-iodoethyl)-5-(3-methyl-1,2,4-oxadiazol-5-yl)-N-(oxan-4-yl)pyrazolo[3,4-b]pyridin-4-amine |
| SMILES | Cc1noc(-c2cnc3c(cnn3C(C)I)c2NC2CCOCC2)n1 |
| InChI | InChI=1S/C16H19IN6O2/c1-9(17)23-15-12(8-19-23)14(21-11-3-5-24-6-4-11)13(7-18-15)16-20-10(2)22-25-16/h7-9,11H,3-6H2,1-2H3,(H,18,21) |
| InChIKey | YNJRCTZJIYVUSE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|