About 3-oxo-4H-pyran-2,6-dicarboxylic acid
3-oxo-4H-pyran-2,6-dicarboxylic acid (PubChem CID 67529874) has the molecular formula C7H6O6
and a molecular weight of 186.12 g/mol. Its IUPAC name is 3-oxo-4H-pyran-2,6-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-oxo-4H-pyran-2,6-dicarboxylic acid |
| PubChem CID | 67529874 |
| Molecular Formula | C7H6O6 |
| Molecular Weight | 186.12 g/mol |
| Exact Mass | 186.02 |
| IUPAC Name | 3-oxo-4H-pyran-2,6-dicarboxylic acid |
| SMILES | O=C(O)C1=CCC(=O)C(C(=O)O)O1 |
| InChI | InChI=1S/C7H6O6/c8-3-1-2-4(6(9)10)13-5(3)7(11)12/h2,5H,1H2,(H,9,10)(H,11,12) |
| InChIKey | JGPSBRNRZUJKNV-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.12 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-4H-pyran-2,6-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-4H-pyran-2,6-dicarboxylic acid?
The IUPAC name of 3-oxo-4H-pyran-2,6-dicarboxylic acid (CID 67529874) is 3-oxo-4H-pyran-2,6-dicarboxylic acid.
What is the SMILES notation for 3-oxo-4H-pyran-2,6-dicarboxylic acid?
The canonical SMILES for 3-oxo-4H-pyran-2,6-dicarboxylic acid is O=C(O)C1=CCC(=O)C(C(=O)O)O1.
What is the InChIKey of 3-oxo-4H-pyran-2,6-dicarboxylic acid?
The InChIKey is JGPSBRNRZUJKNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O6/c8-3-1-2-4(6(9)10)13-5(3)7(11)12/h2,5H,1H2,(H,9,10)(H,11,12).
What are the key properties of 3-oxo-4H-pyran-2,6-dicarboxylic acid?
3-oxo-4H-pyran-2,6-dicarboxylic acid has a molecular weight of 186.12 g/mol, XLogP of -0.60, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-4H-pyran-2,6-dicarboxylic acid is sourced from PubChem (CID 67529874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).