C12H14O6S — CID 67530283
4-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol (PubChem CID 67530283) has the molecular formula C12H14O6S and a molecular weight of 286.30 g/mol. Its IUPAC name is 4-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 67530283 |
| Molecular Formula | C12H14O6S |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 4-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)sulfonylcyclohexa-2,4-diene-1,1-diol |
| SMILES | O=S(=O)(C1=CCC(O)(O)C=C1)C1=CCC(O)(O)C=C1 |
| InChI | InChI=1S/C12H14O6S/c13-11(14)5-1-9(2-6-11)19(17,18)10-3-7-12(15,16)8-4-10/h1-5,7,13-16H,6,8H2 |
| InChIKey | YMVXZMOEVXBZTE-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|