About ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate
ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate (PubChem CID 67530985) has the molecular formula C13H17Br2NO3
and a molecular weight of 395.09 g/mol. Its IUPAC name is ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate |
| PubChem CID | 67530985 |
| Molecular Formula | C13H17Br2NO3 |
| Molecular Weight | 395.09 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate |
| SMILES | CCOC(=O)c1onc(C2(Br)CCCCC2)c1CBr |
| InChI | InChI=1S/C13H17Br2NO3/c1-2-18-12(17)10-9(8-14)11(16-19-10)13(15)6-4-3-5-7-13/h2-8H2,1H3 |
| InChIKey | QSVQSQZRUJNWSH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.09 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate?
The IUPAC name of ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate (CID 67530985) is ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate.
What is the SMILES notation for ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate?
The canonical SMILES for ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate is CCOC(=O)c1onc(C2(Br)CCCCC2)c1CBr.
What is the InChIKey of ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate?
The InChIKey is QSVQSQZRUJNWSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17Br2NO3/c1-2-18-12(17)10-9(8-14)11(16-19-10)13(15)6-4-3-5-7-13/h2-8H2,1H3.
What are the key properties of ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate?
ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate has a molecular weight of 395.09 g/mol, XLogP of 4.30, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(1-bromocyclohexyl)-4-(bromomethyl)-1,2-oxazole-5-carboxylate is sourced from PubChem (CID 67530985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).