About 1-phenyl-10H-phenoxazine;hydrobromide
1-phenyl-10H-phenoxazine;hydrobromide (PubChem CID 67531032) has the molecular formula C18H14BrNO
and a molecular weight of 340.22 g/mol. Its IUPAC name is 1-phenyl-10H-phenoxazine;hydrobromide.
Molecular Properties
| Compound Name | 1-phenyl-10H-phenoxazine;hydrobromide |
| PubChem CID | 67531032 |
| Molecular Formula | C18H14BrNO |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 1-phenyl-10H-phenoxazine;hydrobromide |
| SMILES | Br.c1ccc(-c2cccc3c2Nc2ccccc2O3)cc1 |
| InChI | InChI=1S/C18H13NO.BrH/c1-2-7-13(8-3-1)14-9-6-12-17-18(14)19-15-10-4-5-11-16(15)20-17;/h1-12,19H;1H |
| InChIKey | SQGLNCXFPIQEBL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-phenyl-10H-phenoxazine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-10H-phenoxazine;hydrobromide?
The IUPAC name of 1-phenyl-10H-phenoxazine;hydrobromide (CID 67531032) is 1-phenyl-10H-phenoxazine;hydrobromide.
What is the SMILES notation for 1-phenyl-10H-phenoxazine;hydrobromide?
The canonical SMILES for 1-phenyl-10H-phenoxazine;hydrobromide is Br.c1ccc(-c2cccc3c2Nc2ccccc2O3)cc1.
What is the InChIKey of 1-phenyl-10H-phenoxazine;hydrobromide?
The InChIKey is SQGLNCXFPIQEBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13NO.BrH/c1-2-7-13(8-3-1)14-9-6-12-17-18(14)19-15-10-4-5-11-16(15)20-17;/h1-12,19H;1H.
What are the key properties of 1-phenyl-10H-phenoxazine;hydrobromide?
1-phenyl-10H-phenoxazine;hydrobromide has a molecular weight of 340.22 g/mol, XLogP of 5.78, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-10H-phenoxazine;hydrobromide is sourced from PubChem (CID 67531032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).