About N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine
N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 67531473) has the molecular formula C16H15Cl2F3N4
and a molecular weight of 391.22 g/mol. Its IUPAC name is N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 67531473 |
| Molecular Formula | C16H15Cl2F3N4 |
| Molecular Weight | 391.22 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cc(NCC2CNCC2c2ccc(Cl)c(Cl)c2)ncn1 |
| InChI | InChI=1S/C16H15Cl2F3N4/c17-12-2-1-9(3-13(12)18)11-7-22-5-10(11)6-23-15-4-14(16(19,20)21)24-8-25-15/h1-4,8,10-11,22H,5-7H2,(H,23,24,25) |
| InChIKey | VUXGHCXQPQICOJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.22 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine (CID 67531473) is N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine is FC(F)(F)c1cc(NCC2CNCC2c2ccc(Cl)c(Cl)c2)ncn1.
What is the InChIKey of N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is VUXGHCXQPQICOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2F3N4/c17-12-2-1-9(3-13(12)18)11-7-22-5-10(11)6-23-15-4-14(16(19,20)21)24-8-25-15/h1-4,8,10-11,22H,5-7H2,(H,23,24,25).
What are the key properties of N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine?
N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 391.22 g/mol, XLogP of 4.22, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(3,4-dichlorophenyl)pyrrolidin-3-yl]methyl]-6-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 67531473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).