C33H42F2N4O6S — CID 67532277
methyl N-[1-[[5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(3-fluorophenyl)phenyl]-1-oxopropan-2-yl]carbamate (PubChem CID 67532277) has the molecular formula C33H42F2N4O6S and a molecular weight of 660.78 g/mol. Its IUPAC name is methyl N-[1-[[5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(3-fluorophenyl)phenyl]-1-oxopropan-2-yl]carbamate.
| Compound Name | methyl N-[1-[[5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(3-fluorophenyl)phenyl]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 67532277 |
| Molecular Formula | C33H42F2N4O6S |
| Molecular Weight | 660.78 g/mol |
| Exact Mass | 660.28 |
| IUPAC Name | methyl N-[1-[[5-[(3-amino-4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-6-hydroxyhexyl]amino]-3-[2-(3-fluorophenyl)phenyl]-1-oxopropan-2-yl]carbamate |
| SMILES | COC(=O)NC(Cc1ccccc1-c1cccc(F)c1)C(=O)NCCCCC(CO)N(CC(C)C)S(=O)(=O)c1ccc(F)c(N)c1 |
| InChI | InChI=1S/C33H42F2N4O6S/c1-22(2)20-39(46(43,44)27-14-15-29(35)30(36)19-27)26(21-40)12-6-7-16-37-32(41)31(38-33(42)45-3)18-24-9-4-5-13-28(24)23-10-8-11-25(34)17-23/h4-5,8-11,13-15,17,19,22,26,31,40H,6-7,12,16,18,20-21,36H2,1-3H3,(H,37,41)(H,38,42) |
| InChIKey | HPXYFZZGYQDNDJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 151.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.78 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|