About 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one
3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one (PubChem CID 67532398) has the molecular formula C11H9BrN2O3S
and a molecular weight of 329.18 g/mol. Its IUPAC name is 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one |
| PubChem CID | 67532398 |
| Molecular Formula | C11H9BrN2O3S |
| Molecular Weight | 329.18 g/mol |
| Exact Mass | 327.95 |
| IUPAC Name | 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one |
| SMILES | O=c1ccc2c(Br)c([N+](=O)[O-])sc2n1CC1CC1 |
| InChI | InChI=1S/C11H9BrN2O3S/c12-9-7-3-4-8(15)13(5-6-1-2-6)10(7)18-11(9)14(16)17/h3-4,6H,1-2,5H2 |
| InChIKey | GUSZMLTYBGBGJR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 65.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one?
The IUPAC name of 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one (CID 67532398) is 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one.
What is the SMILES notation for 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one?
The canonical SMILES for 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one is O=c1ccc2c(Br)c([N+](=O)[O-])sc2n1CC1CC1.
What is the InChIKey of 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one?
The InChIKey is GUSZMLTYBGBGJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2O3S/c12-9-7-3-4-8(15)13(5-6-1-2-6)10(7)18-11(9)14(16)17/h3-4,6H,1-2,5H2.
What are the key properties of 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one?
3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one has a molecular weight of 329.18 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-(cyclopropylmethyl)-2-nitrothieno[2,3-b]pyridin-6-one is sourced from PubChem (CID 67532398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).