About [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid
[(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid (PubChem CID 67532473) has the molecular formula C7H13N5O2
and a molecular weight of 199.21 g/mol. Its IUPAC name is [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid.
Molecular Properties
| Compound Name | [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid |
| PubChem CID | 67532473 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid |
| SMILES | CC(C)(C)[C@H](NC(=O)O)c1nn[nH]n1 |
| InChI | InChI=1S/C7H13N5O2/c1-7(2,3)4(8-6(13)14)5-9-11-12-10-5/h4,8H,1-3H3,(H,13,14)(H,9,10,11,12)/t4-/m1/s1 |
| InChIKey | IMJPOSPVTGYKDJ-SCSAIBSYSA-N |
| XLogP | 0.55 |
| TPSA | 103.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid?
The IUPAC name of [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid (CID 67532473) is [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid.
What is the SMILES notation for [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid?
The canonical SMILES for [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid is CC(C)(C)[C@H](NC(=O)O)c1nn[nH]n1.
What is the InChIKey of [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid?
The InChIKey is IMJPOSPVTGYKDJ-SCSAIBSYSA-N. The full InChI is InChI=1S/C7H13N5O2/c1-7(2,3)4(8-6(13)14)5-9-11-12-10-5/h4,8H,1-3H3,(H,13,14)(H,9,10,11,12)/t4-/m1/s1.
What are the key properties of [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid?
[(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid has a molecular weight of 199.21 g/mol, XLogP of 0.55, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-2,2-dimethyl-1-(2H-tetrazol-5-yl)propyl]carbamic acid is sourced from PubChem (CID 67532473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).