About 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one
5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (PubChem CID 67532672) has the molecular formula C16H13NO5S
and a molecular weight of 331.35 g/mol. Its IUPAC name is 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
Molecular Properties
| Compound Name | 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| PubChem CID | 67532672 |
| Molecular Formula | C16H13NO5S |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one |
| SMILES | O=C1Nc2ccc(S(=O)(=O)c3ccccc3)cc2C12OCCO2 |
| InChI | InChI=1S/C16H13NO5S/c18-15-16(21-8-9-22-16)13-10-12(6-7-14(13)17-15)23(19,20)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,17,18) |
| InChIKey | LPEFJLNLVKTIEC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
The IUPAC name of 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one (CID 67532672) is 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one.
What is the SMILES notation for 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
The canonical SMILES for 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one is O=C1Nc2ccc(S(=O)(=O)c3ccccc3)cc2C12OCCO2.
What is the InChIKey of 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
The InChIKey is LPEFJLNLVKTIEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5S/c18-15-16(21-8-9-22-16)13-10-12(6-7-14(13)17-15)23(19,20)11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H,17,18).
What are the key properties of 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one?
5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one has a molecular weight of 331.35 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5'-(benzenesulfonyl)spiro[1,3-dioxolane-2,3'-1H-indole]-2'-one is sourced from PubChem (CID 67532672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).