About butyl(trichloro)silane;dichloro(diphenyl)silane
butyl(trichloro)silane;dichloro(diphenyl)silane (PubChem CID 67532832) has the molecular formula C16H19Cl5Si2
and a molecular weight of 444.77 g/mol. Its IUPAC name is butyl(trichloro)silane;dichloro(diphenyl)silane.
Molecular Properties
| Compound Name | butyl(trichloro)silane;dichloro(diphenyl)silane |
| PubChem CID | 67532832 |
| Molecular Formula | C16H19Cl5Si2 |
| Molecular Weight | 444.77 g/mol |
| Exact Mass | 441.95 |
| IUPAC Name | butyl(trichloro)silane;dichloro(diphenyl)silane |
| SMILES | CCCC[Si](Cl)(Cl)Cl.Cl[Si](Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10Cl2Si.C4H9Cl3Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3-4-8(5,6)7/h1-10H;2-4H2,1H3 |
| InChIKey | HDPBJDACMUIIST-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.77 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze butyl(trichloro)silane;dichloro(diphenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl(trichloro)silane;dichloro(diphenyl)silane?
The IUPAC name of butyl(trichloro)silane;dichloro(diphenyl)silane (CID 67532832) is butyl(trichloro)silane;dichloro(diphenyl)silane.
What is the SMILES notation for butyl(trichloro)silane;dichloro(diphenyl)silane?
The canonical SMILES for butyl(trichloro)silane;dichloro(diphenyl)silane is CCCC[Si](Cl)(Cl)Cl.Cl[Si](Cl)(c1ccccc1)c1ccccc1.
What is the InChIKey of butyl(trichloro)silane;dichloro(diphenyl)silane?
The InChIKey is HDPBJDACMUIIST-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2Si.C4H9Cl3Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-2-3-4-8(5,6)7/h1-10H;2-4H2,1H3.
What are the key properties of butyl(trichloro)silane;dichloro(diphenyl)silane?
butyl(trichloro)silane;dichloro(diphenyl)silane has a molecular weight of 444.77 g/mol, XLogP of 6.16, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for butyl(trichloro)silane;dichloro(diphenyl)silane is sourced from PubChem (CID 67532832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).