About 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid
7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid (PubChem CID 67533194) has the molecular formula C11H13NO4
and a molecular weight of 223.23 g/mol. Its IUPAC name is 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid.
Molecular Properties
| Compound Name | 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid |
| PubChem CID | 67533194 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid |
| SMILES | CC1(C(=O)O)CC=CC2=C1N(C(=O)O)CC2 |
| InChI | InChI=1S/C11H13NO4/c1-11(9(13)14)5-2-3-7-4-6-12(8(7)11)10(15)16/h2-3H,4-6H2,1H3,(H,13,14)(H,15,16) |
| InChIKey | FOVPTZZVGYMNPW-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid?
The IUPAC name of 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid (CID 67533194) is 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid.
What is the SMILES notation for 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid?
The canonical SMILES for 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid is CC1(C(=O)O)CC=CC2=C1N(C(=O)O)CC2.
What is the InChIKey of 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid?
The InChIKey is FOVPTZZVGYMNPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO4/c1-11(9(13)14)5-2-3-7-4-6-12(8(7)11)10(15)16/h2-3H,4-6H2,1H3,(H,13,14)(H,15,16).
What are the key properties of 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid?
7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid has a molecular weight of 223.23 g/mol, XLogP of 1.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3,6-dihydro-2H-indole-1,7-dicarboxylic acid is sourced from PubChem (CID 67533194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).