C25H20Cl2N6 — CID 67533424
1-(2,3-dichlorophenyl)-2-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 67533424) has the molecular formula C25H20Cl2N6 and a molecular weight of 475.38 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-2-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 1-(2,3-dichlorophenyl)-2-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 67533424 |
| Molecular Formula | C25H20Cl2N6 |
| Molecular Weight | 475.38 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-2-[[4-(2H-tetrazol-5-yl)phenyl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Clc1cccc(C2c3[nH]c4ccccc4c3CCN2Cc2ccc(-c3nn[nH]n3)cc2)c1Cl |
| InChI | InChI=1S/C25H20Cl2N6/c26-20-6-3-5-19(22(20)27)24-23-18(17-4-1-2-7-21(17)28-23)12-13-33(24)14-15-8-10-16(11-9-15)25-29-31-32-30-25/h1-11,24,28H,12-14H2,(H,29,30,31,32) |
| InChIKey | FBFWXNIBFVETIF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 73.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.38 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|