About 2,3-diphenyl-4,5-dithiophen-2-ylthiophene
2,3-diphenyl-4,5-dithiophen-2-ylthiophene (PubChem CID 67533683) has the molecular formula C24H16S3
and a molecular weight of 400.59 g/mol. Its IUPAC name is 2,3-diphenyl-4,5-dithiophen-2-ylthiophene.
Molecular Properties
| Compound Name | 2,3-diphenyl-4,5-dithiophen-2-ylthiophene |
| PubChem CID | 67533683 |
| Molecular Formula | C24H16S3 |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | 2,3-diphenyl-4,5-dithiophen-2-ylthiophene |
| SMILES | c1ccc(-c2sc(-c3cccs3)c(-c3cccs3)c2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H16S3/c1-3-9-17(10-4-1)21-22(19-13-7-15-25-19)24(20-14-8-16-26-20)27-23(21)18-11-5-2-6-12-18/h1-16H |
| InChIKey | BKVXLNQITDLBAX-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-diphenyl-4,5-dithiophen-2-ylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-diphenyl-4,5-dithiophen-2-ylthiophene?
The IUPAC name of 2,3-diphenyl-4,5-dithiophen-2-ylthiophene (CID 67533683) is 2,3-diphenyl-4,5-dithiophen-2-ylthiophene.
What is the SMILES notation for 2,3-diphenyl-4,5-dithiophen-2-ylthiophene?
The canonical SMILES for 2,3-diphenyl-4,5-dithiophen-2-ylthiophene is c1ccc(-c2sc(-c3cccs3)c(-c3cccs3)c2-c2ccccc2)cc1.
What is the InChIKey of 2,3-diphenyl-4,5-dithiophen-2-ylthiophene?
The InChIKey is BKVXLNQITDLBAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H16S3/c1-3-9-17(10-4-1)21-22(19-13-7-15-25-19)24(20-14-8-16-26-20)27-23(21)18-11-5-2-6-12-18/h1-16H.
What are the key properties of 2,3-diphenyl-4,5-dithiophen-2-ylthiophene?
2,3-diphenyl-4,5-dithiophen-2-ylthiophene has a molecular weight of 400.59 g/mol, XLogP of 8.54, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-diphenyl-4,5-dithiophen-2-ylthiophene is sourced from PubChem (CID 67533683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).