C16H32N6O — CID 67533698
1-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol (PubChem CID 67533698) has the molecular formula C16H32N6O and a molecular weight of 324.47 g/mol. Its IUPAC name is 1-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol.
| Compound Name | 1-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 67533698 |
| Molecular Formula | C16H32N6O |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 1-[[4,6-bis(butylamino)-1,3,5-triazin-2-yl]amino]pentan-1-ol |
| SMILES | CCCCNc1nc(NCCCC)nc(NC(O)CCCC)n1 |
| InChI | InChI=1S/C16H32N6O/c1-4-7-10-13(23)19-16-21-14(17-11-8-5-2)20-15(22-16)18-12-9-6-3/h13,23H,4-12H2,1-3H3,(H3,17,18,19,20,21,22) |
| InChIKey | ZUYSBLVZEANWQP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|