C9H17N3 — CID 67533921
2,4-dimethyl-2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidine (PubChem CID 67533921) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 2,4-dimethyl-2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidine.
| Compound Name | 2,4-dimethyl-2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidine |
|---|---|
| PubChem CID | 67533921 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 2,4-dimethyl-2,3,4,6,7,8-hexahydro-1H-pyrimido[1,2-a]pyrimidine |
| SMILES | CC1CC(C)N2CCCN=C2N1 |
| InChI | InChI=1S/C9H17N3/c1-7-6-8(2)12-5-3-4-10-9(12)11-7/h7-8H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | JAQPBKRMYZOTHW-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |